Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
suberic acid

Inventory

EC number:
208-010-9
EC name:
Suberic acid
CAS number:
505-48-6
CAS number:
505-48-6
Synonyms
Names:
Octanedioic acid

Molecular and structural information

Molecular formula:
C8H14O4
Molecular weight:
174.194
SMILES notation:
OC(=O)CCCCCCC(=O)O
InChl:
InChI=1/C8H14O4/c9-7(10)5-3-1-2-4-6-8(11)12/h1-6H2,(H,9,10)(H,11,12)
Structural formula:
Chemical structure

Related substances