Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
Trifluoroborane, dihydrate

Inventory

CAS number:
13319-75-0
Synonyms
Names:
Boron trifluoride dihydrate
Boron trifluoride dihydrate complex

Molecular and structural information

Molecular formula:
BF3H4O2
Molecular weight:
103.84
SMILES notation:
B(F)(F)F.O.O
InChl:
InChI=1S/BF3.2H2O/c2-1(3)4;;/h;2*1H2
Structural formula:
Chemical structure

Related substances