Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
6-chloropyridine-3-carboxylic acid

Inventory

EC number:
226-201-5
EC name:
6-chloronicotinic acid
CAS number:
5326-23-8
CAS number:
5326-23-8
Synonyms
Names:
Ja752-K

Molecular and structural information

Molecular formula:
C6H4ClNO2
Molecular weight:
157.55
SMILES notation:
OC(=O)c1cnc(Cl)cc1
InChl:
InChI=1S/C6H4ClNO2/c7-5-2-1-4(3-8-5)6(9)10/h1-3H,(H,9,10)
Structural formula:
Chemical structure

Related substances