Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
tridecanedioic acid

Inventory

EC number:
208-011-4
EC name:
Tridecanedioic acid
CAS number:
505-52-2
CAS number:
505-52-2
Synonyms
Names:
Brassylic acid
Tridecanedioic acid
Undecane-1,11-dicarboxylic acid
tridecanedioic acid

Molecular and structural information

Molecular formula:
C13H24O4
Molecular weight:
244.327
SMILES notation:
OC(=O)CCCCCCCCCCCC(=O)O
InChl:
InChI=1/C13H24O4/c14-12(15)10-8-6-4-2-1-3-5-7-9-11-13(16)17/h1-11H2,(H,14,15)(H,16,17)
Structural formula:
Chemical structure

Related substances