Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
[3-({[3-(Trihydroxysilyl)propyl]disulfanyl}disulfanyl)propyl]silanetriol

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C6H18O6S4Si2
Molecular weight:
370.62
SMILES notation:
O[Si](CCCSSSSCCC[Si](O)(O)O)(O)O
Structural formula:
Chemical structure

Related substances