Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2-[2-(2-hydroxyethoxy)ethoxycarbonyl]benzoic acid

Inventory

EC number:
218-610-2
EC name:
2-(2-hydroxyethoxy)ethyl hydrogen phthalate
CAS number:
2202-98-4
CAS number:
2202-98-4
Synonyms
Names:
Identifier:
IUPAC name
2-{[2-(2-hydroxyethoxy)ethoxy]carbonyl}benzoic acid

Molecular and structural information

Molecular formula:
C12H14O6
Molecular weight:
254.24
SMILES notation:
OCCOCCOC(=O)C1=C(C=CC=C1)C(O)=O
InChl:
1/C12H14O6/c13-5-6-17-7-8-18-12(16)10-4-2-1-3-9(10)11(14)15/h1-4,13H,5-8H2,(H,14,15)
Structural formula:
Chemical structure

Related substances

Categories Display