Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
cyclohexanecarboxylic acid

Inventory

EC number:
202-711-3
EC name:
Cyclohexanecarboxylic acid
CAS number:
98-89-5
CAS number:
98-89-5
Synonyms
Names:
Cyclohexanecarboxylic acid
Hexahydrobenzoic acid
Identifier:
IUPAC name
Cyclohexanecarboxylic acid
Identifier:
IUPAC name
cyclohexane carboxylic acid
Identifier:
PubChem
Carboxycyclohexane
Identifier:
PubChem
Cyclohexanoic acid
Identifier:
PubChem
Cyclohexylcarboxylic acid
Identifier:
PubChem
Hexahydrobenzoic acid
Identifier:
other: SMILES notation
C1CCC(CC1)C(=O)O
Identifier:
other: InChl
InChI=1/C7H12O2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2,(H,8,9)
Identifier:
other: InChl
InChI=1S/C7H12O2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2,(H,8,9)
cyclohexanecarboxylic acid

Molecular and structural information

Molecular formula:
C7H12O2
Molecular weight:
128.169
SMILES notation:
OC(=O)C1CCCCC1
InChl:
InChI=1/C7H12O2/c8-7(9)6-4-2-1-3-5-6/h6H,1-5H2,(H,8,9)
Structural formula:
Chemical structure

Related substances