Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
nonanoic acid

Inventory

EC number:
203-931-2
EC name:
Nonanoic acid
CAS number:
112-05-0
CAS number:
112-05-0
Synonyms
Names:
Nonanoic acid

Molecular and structural information

Molecular formula:
C9H18O2
Molecular weight:
158.238
SMILES notation:
CCCCCCCCC(=O)O
InChl:
InChI=1/C9H18O2/c1-2-3-4-5-6-7-8-9(10)11/h2-8H2,1H3,(H,10,11)
Structural formula:
Chemical structure

Related substances