Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
(2S)-2-hydroxypropanoic acid

Inventory

EC number:
201-196-2
EC name:
L-(+)-lactic acid
CAS number:
79-33-4
CAS number:
79-33-4
Synonyms
Names:
Identifier:
common name
L-(+)-lactic acid
Identifier:
common name
L-lactic acid

Molecular and structural information

Molecular formula:
C3H6O3
Molecular weight:
ca. 90.078
SMILES notation:
C[C@@H](C(=O)O)O
InChl:
InChI=1S/C3H6O3/c1-2(4)3(5)6/h2,4H,1H3,(H,5,6)/t2-/m0/s1
Structural formula:
Chemical structure

Related substances