Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
sodium octadeca-9,12-dienoate

Inventory

EC number:
212-491-0
EC name:
Sodium (9Z,12Z)-octadeca-9,12-dienoate
CAS number:
822-17-3
CAS number:
822-17-3
Synonyms
Names:
9,12-Octadecadienoic acid (9Z,12Z)-, sodium salt
9,12-Octadecadienoic acid (Z,Z)-, sodium salt

Molecular and structural information

Molecular formula:
C18H32O2.Na
Molecular weight:
302.427
SMILES notation:
[Na+].CCCCC\C=C/C\C=C/CCCCCCCC(=O)[O-]
InChl:
InChI=1/C18H32O2.Na/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;/h6-7,9-10H,2-5,8,11-17H2,1H3,(H,19,20);/q;+1/p-1
Structural formula:
Chemical structure

Related substances