Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1,2-Naphtoquinonediazide-5)sulfonylchloride (or sulfonic acid)esters with 4,6-bis(1-(4-hydroxyphenyl)-1-methylethyl)-1,3-dihydroxybenzene

Inventory

EC number:
433-990-1
EC name:
-
CAS number:
-
Description:
REAP
Synonyms
Names:
1,2-Naphtoquinonediazide-5-sulfonylchloride (or sulfonic acid) esters with 4,6-bis(1-(4-hydroxyphenyl)-1-methylethyl)-1,3-dihydroxybenzene

Molecular and structural information

Molecular formula:
1. C24H26O4 (MW 378.468)
2. C34H30N2O7S (MW 610.68)
3. C44H34N4O10S2 (MW 842.89)
SMILES notation:
1. CC(C)(c1cc(c(O)cc1O)C(C)(C)c2ccc(O)cc2)c3ccc(O)cc3
2. Oc1ccc(cc1)C(C)(C)c2cc(c(O)cc2O)C(C)(C)c3ccc(cc3)OS(=O)(=O)c5cccc4c5C=C\C(=[N+]=[N-])C4=O
3. O=C1c2cccc(c2C=C\C1=[N+]=[N-])S(=O)(=O)Oc3ccc(cc3)C(C)(C)c4cc(c(O)cc4O)C(C)(C)c5ccc(cc5)OS(=O)(=O)c7cccc6c7C=C\C(=[N+]=[N-])C6=O

Related substances