Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
[({[Hydroxy(Oxo)Zirconio]Oxy}Carbonyl)Oxy]Zirconiumoylol

Inventory

EC number:
260-633-5
EC name:
[μ-[carbonato(2-)-O:O']]dihydroxydioxodizirconium
CAS number:
57219-64-4
CAS number:
57219-64-4

Synonyms

Molecular and structural information

Molecular formula:
CH2O7Zr2
Molecular weight:
ca. 308.47
SMILES notation:
C(O[Zr](=O)O)(O[Zr](=O)O)=O
Structural formula:
Chemical structure

Related substances