Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
9-(2-carboxyphenyl)-3,6-bis(diethylamino)xanthenium chloride

Inventory

EC number:
201-383-9
EC name:
9-(2-carboxyphenyl)-3,6-bis(diethylamino)xanthylium chloride
CAS number:
81-88-9
CAS number:
81-88-9
Synonyms
Names:
Identifier:
Colour Index
C.I 45170
Identifier:
common name
D&C Red 19
Identifier:
common name
Rhodamine B

Molecular and structural information

Molecular formula:
C28H31N2O3.Cl
Molecular weight:
479.01
SMILES notation:
c1(c2c(oc3c1ccc(\c3)=[N+](/CC)CC)cc(N(CC)CC)cc2)c1c(cccc1)C(O)=O.[ClH-]
InChl:
1S/C28H30N2O3.ClH/c1-5-29(6-2)19-13-15-23-25(17-19)33-26-18-20(30(7-3)8-4)14-16-24(26)27(23)21-11-9-10-12-22(21)28(31)32;/h9-18H,5-8H2,1-4H3;1H
Structural formula:
Chemical structure

Related substances

Categories Display