Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
pentanoyl chloride

Inventory

EC number:
211-330-1
EC name:
Valeryl chloride
CAS number:
638-29-9
CAS number:
638-29-9
Synonyms
Names:
Pentanoyl chloride
n-pentanoyl chloride
n-valeroyl chloride
n-valeryl chloride
pentanoyl chloride
valeryl chloride
pentanoyl chloride

Molecular and structural information

Molecular formula:
C5H9ClO
Molecular weight:
120.58
SMILES notation:
CCCCC(=O)Cl
InChl:
InChI=1/C5H9ClO/c1-2-3-4-5(6)7/h2-4H2,1H3
Structural formula:
Chemical structure

Related substances

Identifier:
CAS number
Identity:
638-29-9