Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
(9Z)-N,N-bis(2-hydroxyethyl)-N-methyloctadec-9-en-1-aminium chloride

Inventory

EC number:
242-332-0
EC name:
Bis(hydroxyethyl)methyloleylammonium chloride
CAS number:
18448-65-2
CAS number:
18448-65-2

Synonyms

Molecular and structural information

Molecular formula:
C23H48NO2.Cl
Molecular weight:
ca. 406
SMILES notation:
[Cl-].OCC[N+](C)(CCCCCCCC/C=C\CCCCCCCC)CCO
InChl:
InChI=1/C23H48NO2.ClH/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-24(2,20-22-25)21-23-26;/h10-11,25-26H,3-9,12-23H2,1-2H3;1H/q+1;/p-1/b11-10-;
Structural formula:
Chemical structure

Related substances