Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2,6-dimethyl-4-(2,2,3-trimethylcyclopent-3-en-1-yl)cyclohex-2-en-1-ol [ISOMER 2]

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C16 H26 O
Molecular weight:
234.4
SMILES notation:
CC1CC(C=C(C1O)C)C2CC=C(C2(C)C)C
Structural formula:
Chemical structure

Related substances