Registration Dossier

Reference substances

Reference substances

IUPAC name:
2-bromoaniline

Inventory

EC number:
210-421-3
EC name:
2-bromoaniline
CAS number:
615-36-1
CAS number:
615-36-1
Synonyms
Names:
2-bromoaniline
Benzenamine, 2-bromo-
2-bromoaniline

Molecular and structural information

Molecular formula:
C6H6BrN
Molecular weight:
172.023
SMILES notation:
Nc1ccccc1Br
InChl:
InChI=1/C6H6BrN/c7-5-3-1-2-4-6(5)8/h1-4H,8H2
Structural formula:
Chemical structure

Related substances