Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
tetrabutylammonium hydrogen sulphate

Inventory

EC number:
251-068-5
EC name:
Tetrabutylammonium hydrogen sulphate
CAS number:
32503-27-8
CAS number:
32503-27-8
Synonyms
Names:
Identifier:
other: Molecular formula
C16H37NO4S
Tetrabutylammonium hydrogen sulphate

Molecular and structural information

Molecular formula:
C16H36N*HO4S
Molecular weight:
ca. 339.5
SMILES notation:
CCCC[N+](CCCC)(CCCC)CCCC.[O-]S(=O)(=O)O
InChl:
1S/C16H36N.H2O4S/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;1-5(2,3)4/h5-16H2,1-4H3;(H2,1,2,3,4)/q+1;/p-1
Structural formula:
Chemical structure

Related substances