Registration Dossier

IUPAC name:
1-(4-chlorophenyl)-2-cyclopropylpropan-1-one

Inventory

CAS number:
123989-29-7

Synonyms

Molecular and structural information

Molecular formula:
C12H13Cl0
Molecular weight:
208.7
SMILES notation:
C1=CC(C(=O)C(C)C2CC2)=CC=C1Cl
Structural formula:
Chemical structure

Related substances