Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
[[(2-hydroxyethyl)imino]bis(methylene)]-bisphosphonic acid

Inventory

EC number:
227-833-4
EC name:
[[(2-hydroxyethyl)imino]bis(methylene)]bisphosphonic acid
CAS number:
5995-42-6
CAS number:
5995-42-6
Synonyms
Names:
Phosphonic acid, (2-hydroxyethyl)imino bis(methylene) bis-
Phosphonic acid, [[(2-hydroxyethyl)imino]bis(methylene)]bis-
Identifier:
IUPAC name
[[(2-hydroxyethyl)imino]bis(methylene)]bisphosphonic acid
Identifier:
IUPAC name
{[(2-hydroxyethyl)imino]bis(methylene)}bis(phosphonic acid)
Identifier:
common name
HEBMP-H (linear)
Identifier:
common name
P,P'-[[(2-hydroxyethyl)imino] bis(methylene)]bisphosphonic acid
Identifier:
other: Molecular formula
C4H13NO7P2 (Constituent 1, linear form) C4H11NO6P2 (Constituent 2, cyclic form)
Identifier:
other: SMILES notation
O=P(O)(O)CN(CP(=O)(O)O)CCO (Constituent 1, linear form) O=P(O)(O)CN1CP(=O)(O)OCC1 (Constituent 2, cyclic form)

Molecular and structural information

Molecular formula:
C4H13NO7P2
Molecular weight:
ca. 249.1
SMILES notation:
OCCN(CP(=O)(O)O)CP(=O)(O)O
InChl:
InChI=1/C4H13NO7P2/c6-2-1-5(3-13(7,8)9)4-14(10,11)12/h6H,1-4H2,(H2,7,8,9)(H2,10,11,12)
Structural formula:
Chemical structure

Related substances