Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
1,1',1''-[methanetriyltris(oxy)]tripropane

Inventory

EC number:
210-704-1
EC name:
1,1',1''-[methylidynetris(oxy)]trispropane
CAS number:
621-76-1
CAS number:
621-76-1
Synonyms
Names:
1,1',1''-[methylidynetris(oxy)]trispropane
Propane, 1,1',1''-[methylidynetris(oxy)]tris-

Molecular and structural information

Molecular formula:
C10H22O3
Molecular weight:
190.28
SMILES notation:
CCCOC(OCCC)OCCC
InChl:
InChI=1/C10H22O3/c1-4-7-11-10(12-8-5-2)13-9-6-3/h10H,4-9H2,1-3H3
Structural formula:
Chemical structure

Related substances