Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2,6-bis(propan-2-yl)aniline

Inventory

EC number:
246-305-4
EC name:
2,6-diisopropylaniline
CAS number:
24544-04-5
CAS number:
24544-04-5
Synonyms
Names:
2,6-bis(1-methylethyl)benzenamine
Benzenamine, 2,6-bis(1-methylethyl)-
2,6-diisopropylaniline

Molecular and structural information

Molecular formula:
C12H19N
Molecular weight:
177.286
SMILES notation:
CC(C)c1cccc(C(C)C)c1N
InChl:
InChI=1/C12H19N/c1-8(2)10-6-5-7-11(9(3)4)12(10)13/h5-9H,13H2,1-4H3
Structural formula:
Chemical structure

Related substances