Registration Dossier

Reference substances

Reference substances

IUPAC name:
(2Z)-(5-amino-1,2,4-thiadiazol-3-yl)(ethoxyimino)acetic acid

Inventory

CAS number:
75028-24-9
Synonyms
Names:
(2Z)-(5-amino-1,2,4-thiadiazol-3-yl)(ethoxyimino)acetic acid

Molecular and structural information

Molecular formula:
C6H8N4O3S
Molecular weight:
216.22
SMILES notation:
CCO/N=C(/c1nc(sn1)N)\C(=O)O
Structural formula:
Chemical structure

Related substances