Registration Dossier

Diss Factsheets

IUPAC name:
2’Deoxy-2’-fluoro-2’-methyl-N-(phenylcarbonyl)-3’,5’-bis-O-(phenylcarbonyl)cytidine

Inventory

CAS number:
817204-32-3

Synonyms

Molecular and structural information

Molecular formula:
C31H26FN3O7
Molecular weight:
571.18
SMILES notation:
C[C@@]1(F)[C@H](OC(C2=CC=CC=C2)=O)[C@@H](COC(C3=CC=CC=C3)=O)O[C@H]1N4C=CC(NC(C5=CC=CC=C5)=O)=NC4=O
InChl:
1S/C31H26FN3O7/c1-31(32)25(42-28(38)22-15-9-4-10-16-22)23(19-40-27(37)21-13-7-3-8-14-21)41-29(31)35-18-17-24(34-30(35)39)33-26(36)20-11-5-2-6-12-20/h2-18,23,25,29H,19H2,1H3,(H,33,34,36,39)/t23-,25-,29-,31-/m1/s1
Structural formula:
Chemical structure

Related substances

Categories Display