rin-dangerous-goods-lists-dir-2008-68
rin-dangerous-goods-lists-dir-2008-68
Inland Transport of Dangerous Goods Directive, Annex II - RID
This list contains the RID Dangerous Goods List, as implemented by the European Union's Directive 2008/68/EC. This Directive applies the European Agreements on the international transport of dangerous goods by road (ADR) and inland waterways (ADN), and the regulations concerning the international carriage of dangerous goods by rail (RID).
| Class |
6.1
|
|
| Labels |
6.1
|
|
| Packing Group |
III
|
|
| UN No. |
1556
|
|
| Classification code |
T4
|
|
| Express parcels |
CE8
|
|
| Hazard identification number |
60
|
|
| RID Tanks | Tank code |
L4BH
|
| Special provisions |
TU15
|
|
| Limited and excepted quantities | Excepted quantities |
E1
|
| Limited quantities |
5 L
|
|
| Packaging | Packaging instructions |
P001
IBC03
LP01
R001
|
| Mixed packing provisions |
MP19
|
|
| Portable tanks and bulk containers | Special provisions |
TP2
TP28
|
| Instructions |
T7
|
|
| Transport category |
2
|
|
| Special provisions for carriage | Loading, unloading & handling |
CW13
CW28
CW31
|
| Packages |
W12
|
|
| Special provisions |
43
274
|
Help
Group members
substance-members-text
Results list is empty
| Name | EC / List no. | CAS no. | Association |
|---|---|---|---|
| Arsenic acid (H3AsO4), calcium salt (7:10) | - | 85949-61-7 | diss.rml.association.type.EXPERT |
| Arsenic sulfide (AsS2) | - | 56320-22-0 | diss.rml.association.type.EXPERT |
| Benzenesulfonic acid, 4-arsenoso- | - | 71130-51-3 | diss.rml.association.type.EXPERT |
| Tripotassium arsenide | 234-949-9 | 12044-21-2 | diss.rml.association.type.EXPERT_ECHA |
| Diphenylarsinecarbonitrile | 245-716-6 | 23525-22-6 | diss.rml.association.type.EXPERT |
| Arsenenous acid, cobalt(2+) salt | - | 85561-28-0 | diss.rml.association.type.EXPERT |
| 3-methyl-4-(pyrrolidin-1-yl)benzenediazonium hexafluoroarsenate | 248-532-4 | 27569-09-1 | diss.rml.association.type.EXPERT_ECHA |
| 2-aminophenylarsonic acid | 218-064-5 | 2045-00-3 | diss.rml.association.type.EXPERT |
| Arsonate | - | 36465-76-6 | diss.rml.association.type.EXPERT |
| N-(p-arsenosophenyl)-1,3,5-triazine-2,4,6-triamine | 244-612-8 | 21840-08-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid, copper salt | 233-286-2 | 10103-61-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsine, dichloromethyl- | 695-189-5 | 593-89-5 | diss.rml.association.type.EXPERT |
| 2-[[7-[(2-arsonophenyl)azo]-1,8-dihydroxy-3,6-disulpho-2-naphthyl]azo]benzoic acid | 223-216-9 | 3772-44-9 | diss.rml.association.type.EXPERT |
| Acetarsol--diethylamine (1:1) | 208-597-1 | 534-33-8 | diss.rml.association.type.EXPERT |
| Indium arsenide | 215-115-3 | 1303-11-3 | diss.rml.association.type.EXPERT_ECHA |
| Methylarsonic acid | 204-705-6 | 124-58-3 | diss.rml.association.type.EXPERT |
| Diphenyldiarsenic acid | 224-845-1 | 4519-32-8 | diss.rml.association.type.EXPERT_ECHA |
| (4-aminophenyl)arsonic acid, compound with piperazine (1:1) | 303-952-8 | 94232-26-5 | diss.rml.association.type.EXPERT |
| Lead hydrogen arsenate | 232-064-2 | 7784-40-9 | diss.rml.association.type.EXPERT_ECHA |
| Sodium hydrogen [4-(acetamido)phenyl]arsonate | 209-558-1 | 585-54-6 | diss.rml.association.type.EXPERT |
| (Carboxymethyl)trimethylarsonium hydroxide inner salt | 634-697-3 | 64436-13-1 | diss.rml.association.type.EXPERT |
| Arsenenic acid | - | 10102-53-1 | diss.rml.association.type.EXPERT |
| Dibismuth tris(methylarsonate) | 286-401-3 | 85237-42-9 | diss.rml.association.type.EXPERT |
| Arsenenous acid, cadmium salt | - | 84953-43-5 | diss.rml.association.type.EXPERT |
| Disodium 3,6-bis[[2-[(dihydroxyarsino)oxy]phenyl]azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 282-453-6 | 84215-47-4 | diss.rml.association.type.EXPERT |
| Manganese hydrogenarsenate | 232-063-7 | 7784-38-5 | diss.rml.association.type.EXPERT_ECHA |
| 10-chloro-5,10-dihydrophenarsazine | 209-433-1 | 578-94-9 | diss.rml.association.type.EXPERT |
| Tribarium diarsenate | 236-762-8 | 13477-04-8 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, calcium salt (2:1) | - | 15194-98-6 | diss.rml.association.type.EXPERT |
| Tin arsenide (Sn4As3) | - | 12397-66-9 | diss.rml.association.type.EXPERT |
| Arsenic acid, copper(2+) salt | 249-916-4 | 29871-13-4 | diss.rml.association.type.EXPERT_ECHA |
| Iron arsenide | - | 39310-41-3 | diss.rml.association.type.EXPERT |
| Aluminium arsenide | 245-255-0 | 22831-42-1 | diss.rml.association.type.EXPERT_ECHA |
| Tryparsamide | 209-070-9 | 554-72-3 | diss.rml.association.type.EXPERT |
| Trilithium arsenate | 236-773-8 | 13478-14-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), lead salt | - | 7645-25-2 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), ammonium salt (2:1) | - | 127795-79-3 | diss.rml.association.type.EXPERT |
| Arsenic disulfide | 627-949-9 | 1303-32-8 | diss.rml.association.type.EXPERT |
| Copper arsonate | 233-644-8 | 10290-12-7 | diss.rml.association.type.EXPERT |
| Arsenenous acid | - | 13768-07-5 | diss.rml.association.type.EXPERT |
| Trisodium 4-[(o-arsonophenyl)azo]-3-oxidonaphthalene-2,7-disulphonate | 258-693-2 | 53669-45-7 | diss.rml.association.type.EXPERT |
| Arsenic acid, sodium salt | 231-547-5 | 7631-89-2 | diss.rml.association.type.EXPERT_ECHA |
| Ethylenebis(diphenylarsine) | 224-629-7 | 4431-24-7 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), lead(4+) salt (2:1), monohydrate | - | 33940-95-3 | diss.rml.association.type.EXPERT |
| Lithium hexafluoroarsenate | 249-963-0 | 29935-35-1 | diss.rml.association.type.EXPERT_ECHA |
| Sodium hydrogen [4-[(hydroxyacetyl)amino]phenyl]arsonate | 205-415-2 | 140-45-4 | diss.rml.association.type.EXPERT |
| (2-Chloroethenyl)arsonous dichloride | - | 541-25-3 | diss.rml.association.type.EXPERT |
| Sodium hydrogen 4-aminophenylarsonate | 204-869-9 | 127-85-5 | diss.rml.association.type.EXPERT |
| Arsenic chloride (AsCl) | - | 17522-78-0 | diss.rml.association.type.EXPERT |
| Arsenic acid | 231-901-9 | 7778-39-4 | diss.rml.association.type.EXPERT_ECHA |
| Chlorotris(triphenylarsine)rhodium | 239-051-0 | 14973-92-3 | diss.rml.association.type.EXPERT |
| Diphenylarsine | 212-589-3 | 829-83-4 | diss.rml.association.type.EXPERT |
| Tricopper arsenide | 234-472-6 | 12005-75-3 | diss.rml.association.type.EXPERT_ECHA |
| Boron arsenide (BAs) | - | 12005-69-5 | diss.rml.association.type.EXPERT |
| Holmium arsenide | 234-476-8 | 12005-92-4 | diss.rml.association.type.EXPERT_ECHA |
| Cobalt arsenide | 265-784-0 | 65453-05-6 | diss.rml.association.type.EXPERT_ECHA |
| Diarsenic trioxide | 215-481-4 | 1327-53-3 | diss.rml.association.type.EXPERT_ECHA |
| Tin arsenide (SnAs) | - | 12044-32-5 | diss.rml.association.type.EXPERT |
| Melarsonyl potassium | 236-405-6 | 13355-00-5 | diss.rml.association.type.EXPERT |
| Propylarsonic acid | 203-482-2 | 107-34-6 | diss.rml.association.type.EXPERT |
| Disodium 4-[(o-arsonophenyl)azo]-3-hydroxynaphthalene-2,7-disulphonate | 222-993-1 | 3688-92-4 | diss.rml.association.type.EXPERT_ECHA |
| Glycobiarsol | 204-143-1 | 116-49-4 | diss.rml.association.type.EXPERT |
| Tris[(8α)-6'-methoxycinchonan-9(R)-ol] arsenite | 303-002-2 | 94138-87-1 | diss.rml.association.type.EXPERT_ECHA |
| Sodium metaarsenate | 239-171-3 | 15120-17-9 | diss.rml.association.type.EXPERT_ECHA |
| Neoarsphenamine | 207-273-7 | 457-60-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, cadmium neodymium(3+) salt (5:1:1) | - | 76871-66-4 | diss.rml.association.type.EXPERT |
| Sodium hydrogen (3-acetamido-4-hydroxyphenyl)arsonate | 227-573-1 | 5892-48-8 | diss.rml.association.type.EXPERT |
| Potassium arsonate | 233-337-9 | 10124-50-2 | diss.rml.association.type.EXPERT |
| Arsenenous acid, manganese(2+) salt | - | 85561-29-1 | diss.rml.association.type.EXPERT |
| Triammonium arsenate | 246-428-3 | 24719-13-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsthinol | 204-361-7 | 119-96-0 | diss.rml.association.type.EXPERT |
| Tritylium hexafluoroarsenate | 207-111-5 | 437-15-0 | diss.rml.association.type.EXPERT_ECHA |
| Nickel arsenide | 248-169-1 | 27016-75-7 | diss.rml.association.type.EXPERT_ECHA |
| Strychnidin-10-one, compd. with methylarsonate (1:1) | 279-614-8 | 80879-64-7 | diss.rml.association.type.EXPERT |
| Oxophenarsine hydrochloride | 208-682-3 | 538-03-4 | diss.rml.association.type.EXPERT_ECHA |
| trisodium;trioxido(oxo)-$l^{5}-arsane;dodecahydrate | - | 13510-46-8 | diss.rml.association.type.EXPERT |
| Arsine | 232-066-3 | 7784-42-1 | diss.rml.association.type.EXPERT |
| Zirconium arsenide | 262-524-8 | 60909-47-9 | diss.rml.association.type.EXPERT_ECHA |
| Sodium hydrogen allylarsonate | 304-710-4 | 94278-22-5 | diss.rml.association.type.EXPERT |
| Arsenous acid, tripotassium salt | - | 36267-15-9 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), magnesium salt, manganese-doped | 310-019-9 | 102110-21-4 | diss.rml.association.type.EXPERT_ECHA |
| Nickel diarsenide | 235-103-1 | 12068-61-0 | diss.rml.association.type.EXPERT_ECHA |
| Disodium hydrogenarsenate | 231-902-4 | 7778-43-0 | diss.rml.association.type.EXPERT_ECHA |
| Tetraphenylarsonium Chloride Hydrochloride Hydrate | 621-302-4 | 123334-18-9 | diss.rml.association.type.EXPERT |
| Trimanganese arsenide | 262-667-6 | 61219-26-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic bromide | 265-296-8 | 64973-06-4 | diss.rml.association.type.EXPERT_ECHA |
| Magnesium arsenate, decahydrate | - | 117746-50-6 | diss.rml.association.type.EXPERT |
| Chlorodiphenylarsine | 211-921-4 | 712-48-1 | diss.rml.association.type.EXPERT |
|
Lead alloy, base, dross
A scum formed on the surface of molten lead-base alloys. Includes those cases in which aluminum is used to remove arsenic, nickel and antimony.
|
273-700-9 | 69011-59-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), copper(2+) salt (4:5) | - | 89054-01-3 | diss.rml.association.type.EXPERT |
| Terbium arsenide | 234-479-4 | 12006-08-5 | diss.rml.association.type.EXPERT_ECHA |
| 4-(4-aminophenylazo)phenylarsonic acid | 230-176-6 | 6966-64-9 | diss.rml.association.type.EXPERT |
| Arsenous acid, iron(3+) salt (1:1) | - | 60168-33-4 | diss.rml.association.type.EXPERT |
| 4-(ethylamino)-2-methylbenzenediazonium hexafluoroarsenate | 264-026-6 | 63217-32-3 | diss.rml.association.type.EXPERT_ECHA |
| Sulfarsphenamine | 210-564-1 | 618-82-6 | diss.rml.association.type.EXPERT_ECHA |
| Tetraphenylarsonium chloride | 208-070-6 | 507-28-8 | diss.rml.association.type.EXPERT |
| Iron bis(arsenate) | 233-275-2 | 10102-50-8 | diss.rml.association.type.EXPERT_ECHA |
| Zinc arsenate, octahydrate | - | 13510-72-0 | diss.rml.association.type.EXPERT |
| Silicic acid (H4SiO4), zinc salt (1:2), arsenic and manganese-doped | 271-895-5 | 68611-46-1 | diss.rml.association.type.EXPERT_ECHA |
| Iron arsenate | 233-274-7 | 10102-49-5 | diss.rml.association.type.EXPERT_ECHA |
| Lanthanum arsenide | 235-502-0 | 12255-04-8 | diss.rml.association.type.EXPERT_ECHA |
| Arsine oxide, dichloro(2-chlorovinyl)- | - | 333-25-5 | diss.rml.association.type.EXPERT |
| Arsine, bis(2-chlorovinyl)chloro- | - | 40334-69-8 | diss.rml.association.type.EXPERT |
| Diarsenic tritelluride | 234-955-1 | 12044-54-1 | diss.rml.association.type.EXPERT_ECHA |
| Methyl 17α-hydroxyyohimban-16α-carboxylate, methylarsonate (1:1) | 279-628-4 | 80925-03-7 | diss.rml.association.type.EXPERT |
| 4-chlorophenylarsonic acid | 226-622-4 | 5440-04-0 | diss.rml.association.type.EXPERT |
| Disodium p-tolylarsonate | 304-956-2 | 94313-58-3 | diss.rml.association.type.EXPERT |
| Tricadmium diarsenide | 234-484-1 | 12006-15-4 | diss.rml.association.type.EXPERT |
| 4-[(2-arsonophenyl)azo]-3-hydroxynaphthalene-2,7-disulphonic acid | 205-058-2 | 132-33-2 | diss.rml.association.type.EXPERT |
| Arsonic acid, methyl-, iron salt (9CI) | - | 33972-75-7 | diss.rml.association.type.EXPERT |
| 4-acetamidophenylarsonic acid | 210-541-6 | 618-22-4 | diss.rml.association.type.EXPERT |
| Tri-p-tolylarsine | 220-776-6 | 2896-10-8 | diss.rml.association.type.EXPERT |
| Silicic acid (H4SiO4), tetraethyl ester, polymer with arsenic oxide (As2O3) | - | 68957-75-5 | diss.rml.association.type.EXPERT |
| 3-formamido-4-hydroxyphenylarsonic acid | 262-085-2 | 60154-16-7 | diss.rml.association.type.EXPERT |
| Boron arsenate | - | 13510-31-1 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), dipotassium salt | - | 21093-83-4 | diss.rml.association.type.EXPERT |
|
Slimes and Sludges, copper refining
A complex combination resulting from copper processing---other than electrolytic.
|
266-977-2 | 67712-00-9 | diss.rml.association.type.EXPERT_ECHA |
| Trinickel bis(arsenate) | 236-771-7 | 13477-70-8 | diss.rml.association.type.EXPERT_ECHA |
| Arsenopyrite, cobaltoan | - | 12414-94-7 | diss.rml.association.type.EXPERT |
| Trifluoroarsine | 232-060-0 | 7784-35-2 | diss.rml.association.type.EXPERT_ECHA |
| Allylarsonic acid | 209-678-4 | 590-34-1 | diss.rml.association.type.EXPERT |
| Diiodo(phenyl)arsine | 228-965-5 | 6380-34-3 | diss.rml.association.type.EXPERT |
| Arsenous acid, copper(2+) salt, hydrate, (2:3:3) | - | 73156-86-2 | diss.rml.association.type.EXPERT |
| 2,6-dimethyl-4-phenylpyrylium hexafluoroarsenate | 282-700-8 | 84304-15-4 | diss.rml.association.type.EXPERT_ECHA |
| iron;iron(3+);methyl-dioxido-oxo-$l^{5}-arsane | - | 6585-53-1 | diss.rml.association.type.EXPERT |
| Manganese arsenate | - | 27526-45-0 | diss.rml.association.type.EXPERT |
| Methyloxoarsine | 209-799-2 | 593-58-8 | diss.rml.association.type.EXPERT |
| Ytterbium arsenide | 234-483-6 | 12006-12-1 | diss.rml.association.type.EXPERT_ECHA |
| Sodium dimethylarsinate | 204-708-2 | 124-65-2 | diss.rml.association.type.EXPERT_ECHA |
| Thallium triarsenide | 281-902-3 | 84057-85-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic chloride (AsCl2) | - | 41996-37-6 | diss.rml.association.type.EXPERT |
|
Flue dust, lead-refining
By-product of refining lead ores obtained from baghouse and electro-static precipitator and as slurry from scrubbers.
|
273-809-1 | 69029-67-0 | diss.rml.association.type.EXPERT_ECHA |
| Dimethylarsinic acid | 200-883-4 | 75-60-5 | diss.rml.association.type.EXPERT_ECHA |
| 10-chloro-10H-phenoxarsine | 220-684-6 | 2865-70-5 | diss.rml.association.type.EXPERT |
| Calcium bis(methylarsonate) | 227-598-8 | 5902-95-4 | diss.rml.association.type.EXPERT |
| Arsenous acid, antimony(3+) salt (1:1) | - | 12523-20-5 | diss.rml.association.type.EXPERT |
| Arsenenous acid, zinc salt | - | 10326-24-6 | diss.rml.association.type.EXPERT |
| Lead arsenite | 233-083-9 | 10031-13-7 | diss.rml.association.type.EXPERT_ECHA |
| Dysprosium arsenide | 234-473-1 | 12005-81-1 | diss.rml.association.type.EXPERT_ECHA |
| 4-hydroxyphenylarsonic acid | 202-641-3 | 98-14-6 | diss.rml.association.type.EXPERT |
| Bis[(2-diphenylarsinoethyl)phenyl]phosphine | 245-756-4 | 23582-05-0 | diss.rml.association.type.EXPERT |
|
Slimes and Sludges, copper-lead ore roasting off gas scrubbing, arsenic-contg.
The product obtained by the purification of copper-lead ore concentrate roasting offgas. Composed primarily of arsenic oxide (As2O3).
|
310-063-9 | 102110-62-3 | diss.rml.association.type.EXPERT_ECHA |
| Gadolinium arsenide | 234-475-2 | 12005-89-9 | diss.rml.association.type.EXPERT_ECHA |
| Triethyl arsenite | 221-543-1 | 3141-12-6 | diss.rml.association.type.EXPERT_ECHA |
| Iron arsenide | 234-947-8 | 12044-16-5 | diss.rml.association.type.EXPERT_ECHA |
| Zinc arsenate | 236-683-9 | 13464-44-3 | diss.rml.association.type.EXPERT_ECHA |
| Disodium 3-[(o-arsonophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 222-600-3 | 3547-38-4 | diss.rml.association.type.EXPERT |
| Antimony arsenic oxide | 264-904-9 | 64475-90-7 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid, calcium salt (1:2) | - | 13464-39-6 | diss.rml.association.type.EXPERT |
| Trisodium arsenate | 236-682-3 | 13464-38-5 | diss.rml.association.type.EXPERT_ECHA |
| Carbarsone | 204-484-6 | 121-59-5 | diss.rml.association.type.EXPERT |
| Methyltriphenylarsonium iodide | 216-108-8 | 1499-33-8 | diss.rml.association.type.EXPERT |
| Manganese arsenide | 234-478-9 | 12005-95-7 | diss.rml.association.type.EXPERT_ECHA |
| Sodium p-arsonobenzenesulphonate | 229-632-7 | 6634-88-4 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), magnesium salt (2:3) | - | 21480-65-9 | diss.rml.association.type.EXPERT |
| Iron tris(dimethylarsinate) | 227-759-2 | 5968-84-3 | diss.rml.association.type.EXPERT |
| Nickel arsenide | - | 12795-30-1 | diss.rml.association.type.EXPERT |
| Tricobalt diarsenate | 246-429-9 | 24719-19-5 | diss.rml.association.type.EXPERT_ECHA |
| Yttrium arsenide | 235-507-8 | 12255-48-0 | diss.rml.association.type.EXPERT_ECHA |
| Arsenous acid, gallium salt (1:1) | - | 24343-41-7 | diss.rml.association.type.EXPERT |
| Germanium arsenide | 235-547-6 | 12271-72-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic chloride | - | 37226-49-6 | diss.rml.association.type.EXPERT |
| Nitarsone | 202-695-8 | 98-72-6 | diss.rml.association.type.EXPERT |
| Copper diarsenite | 240-574-1 | 16509-22-1 | diss.rml.association.type.EXPERT_ECHA |
| Ammonium copper arsenate | 251-151-6 | 32680-29-8 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic tribromide | 232-057-4 | 7784-33-0 | diss.rml.association.type.EXPERT_ECHA |
| Arsonic acid, methyl-, compd. with 1-octanamine (1:1) | - | 6379-37-9 | diss.rml.association.type.EXPERT |
| Tribarium diarsenide | 235-508-3 | 12255-50-4 | diss.rml.association.type.EXPERT_ECHA |
| 4-Aminophenylarsenoxide | - | 1122-90-3 | diss.rml.association.type.EXPERT |
| Tristrontium diarsenide | 254-407-5 | 39297-24-0 | diss.rml.association.type.EXPERT_ECHA |
| Tetraphenylarsonium (hydrogen dichloride) | 244-144-4 | 21006-73-5 | diss.rml.association.type.EXPERT |
| o-phenylenebis(dimethylarsine) | 236-227-9 | 13246-32-7 | diss.rml.association.type.EXPERT |
| Arsenic sulfide (As2S4) | - | - | diss.rml.association.type.EXPERT |
| Strychnidin-10-one, arsenite (1:1) | 309-388-9 | 100258-44-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsanilic acid | 202-674-3 | 98-50-0 | diss.rml.association.type.EXPERT |
| Potassium hexafluoroarsenate | 241-102-7 | 17029-22-0 | diss.rml.association.type.EXPERT_ECHA |
| 4-cyclohexyl-2,6-dimethylpyrylium hexafluoroarsenate | 282-701-3 | 84304-16-5 | diss.rml.association.type.EXPERT_ECHA |
| Neodymium arsenide | 235-504-1 | 12255-09-3 | diss.rml.association.type.EXPERT_ECHA |
| Methyldiphenylarsine | 213-414-3 | 945-48-2 | diss.rml.association.type.EXPERT |
| 4-(2-chloroacetamido)phenylarsonic acid | 226-569-7 | 5425-62-7 | diss.rml.association.type.EXPERT |
| Arsonic acid, methyl-, calcium salt (1:1) | - | 6423-72-9 | diss.rml.association.type.EXPERT |
| Arsenenous acid, nickel(2+) salt | - | 33992-49-3 | diss.rml.association.type.EXPERT |
| Trisilver arsenite | 232-048-5 | 7784-08-9 | diss.rml.association.type.EXPERT_ECHA |
| Ferric arsenite, basic | - | 63989-69-5 | diss.rml.association.type.EXPERT |
| Antimony arsenate | 249-347-1 | 28980-47-4 | diss.rml.association.type.EXPERT_ECHA |
| Arsenous acid, zinc salt (2:3) | - | 28837-97-0 | diss.rml.association.type.EXPERT |
| Roxarsone | 204-453-7 | 121-19-7 | diss.rml.association.type.EXPERT_ECHA |
| Strontium arsenide (SrAs3) | - | 61462-16-6 | diss.rml.association.type.EXPERT |
| Triphenylarsine | 210-032-9 | 603-32-7 | diss.rml.association.type.EXPERT |
| Triphenylsulphonium hexafluoroarsenate(1-) | 261-009-5 | 57900-42-2 | diss.rml.association.type.EXPERT_ECHA |
| Dichromium arsenide | 235-499-6 | 12254-85-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic pentachloride | - | 22441-45-8 | diss.rml.association.type.EXPERT |
| Disodium 3,6-bis[(o-arsonophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 263-516-7 | 62337-00-2 | diss.rml.association.type.EXPERT_ECHA |
| Acetarsol | 202-582-3 | 97-44-9 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), copper(2+) salt (2:3) | - | - | diss.rml.association.type.EXPERT |
| 4-(diethylamino)-2-ethoxybenzenediazonium hexafluoroarsenate | 264-027-1 | 63217-33-4 | diss.rml.association.type.EXPERT_ECHA |
| Diarsenic acid | - | 13453-15-1 | diss.rml.association.type.EXPERT |
| Trilead diarsenate | 222-979-5 | 3687-31-8 | diss.rml.association.type.EXPERT_ECHA |
| Tetramethyldiarsine | 207-440-4 | 471-35-2 | diss.rml.association.type.EXPERT |
| 10-[(dimethylthiocarbamoyl)thio]-5,10-dihydrophenarsazine | 225-368-1 | 4808-24-6 | diss.rml.association.type.EXPERT |
| Arsenic sulfide | 215-117-4 | 1303-33-9 | diss.rml.association.type.EXPERT_ECHA |
| Tetraphenylarsonium bromide | 208-069-0 | 507-27-7 | diss.rml.association.type.EXPERT |
| Samarium arsenide | 235-506-2 | 12255-39-9 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, lutetium(3+) salt | - | 76871-65-3 | diss.rml.association.type.EXPERT |
| Thulium arsenide | 234-482-0 | 12006-10-9 | diss.rml.association.type.EXPERT_ECHA |
| Disilver arsenide | 274-573-2 | 70333-07-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), copper(2+) salt (1:1), sesquihydrate | - | 88442-64-2 | diss.rml.association.type.EXPERT |
| Benzenesulfonic acid, 4-arsenoso-, sodium salt | - | 71130-50-2 | diss.rml.association.type.EXPERT |
| Arsenic sulfide | 235-720-6 | 12612-21-4 | diss.rml.association.type.EXPERT_ECHA |
| Strychnine arsenate | 233-970-0 | 10476-82-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsonic acid, disodium salt | - | 13466-06-3 | diss.rml.association.type.EXPERT |
| Arsenous acid, tricopper(1+) salt | - | 33382-64-8 | diss.rml.association.type.EXPERT |
| Platinum arsenide (PtAs2) | - | 12044-52-9 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), lead(2+) salt (4:5) | - | 89054-03-5 | diss.rml.association.type.EXPERT |
| Arsenenous acid, lithium salt | - | 72845-34-2 | diss.rml.association.type.EXPERT |
| Arsenic trichloride | - | 60646-36-8 | diss.rml.association.type.EXPERT |
| Niobium arsenide | 235-503-6 | 12255-08-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, antimony(3+) salt | - | 83877-96-7 | diss.rml.association.type.EXPERT |
| Arsenenous acid, praseodymium(3+) salt | - | 86859-92-9 | diss.rml.association.type.EXPERT |
| Arsine, tris(2-chloroethenyl)- | - | 40334-70-1 | diss.rml.association.type.EXPERT |
| Ammonium magnesium arsenate | - | 14644-70-3 | diss.rml.association.type.EXPERT |
| Strontium arsenite (Sr(As2O4)) | - | 91724-16-2 | diss.rml.association.type.EXPERT |
| Bromo(hydroxytetraphenylarsoranato)magnesium | 264-254-6 | 63468-73-5 | diss.rml.association.type.EXPERT |
| Difetarsone | 222-866-0 | 3639-19-8 | diss.rml.association.type.EXPERT |
| Gallium zinc triarsenide | 308-577-3 | 98106-56-0 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, rubidium salt | - | 85906-44-1 | diss.rml.association.type.EXPERT |
| Dichloro(ethyl)arsine | 209-919-3 | 598-14-1 | diss.rml.association.type.EXPERT |
| Bis(pentane-2,4-dionato-O,O')boron(1+) hexafluoroarsenate(1-) | 272-591-5 | 68892-01-3 | diss.rml.association.type.EXPERT_ECHA |
| Gallium arsenide phosphide | - | 106097-61-4 | diss.rml.association.type.EXPERT |
| Disodium methylarsonate | 205-620-7 | 144-21-8 | diss.rml.association.type.EXPERT |
| ARSENIC ACID (H3ASO4), HEMIHYDRATE | - | 7774-41-6 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), copper(2+) salt (4:1) | - | 102525-64-4 | diss.rml.association.type.EXPERT |
| 2,7-(bis(2-arsonophenylazo))-1,8-dihydroxynaphthalene-3,6-disulphonic acid | 216-788-6 | 1668-00-4 | diss.rml.association.type.EXPERT |
| Pentahydroxyarsorane | 232-096-7 | 7786-36-9 | diss.rml.association.type.EXPERT_ECHA |
| Trisodium 3-[(o-arsonatophenyl)azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 266-069-6 | 66019-20-3 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), copper(2+) salt (1:1) | - | 13464-31-8 | diss.rml.association.type.EXPERT |
| Cobalt arsenide (CoAs3) | - | 12256-04-1 | diss.rml.association.type.EXPERT |
| Difetarsone disodium | 208-209-0 | 515-76-4 | diss.rml.association.type.EXPERT |
| Tricalcium diarsenide | 235-509-9 | 12255-53-7 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid, (H3-As-O4), lead(4+) salt (4:3) | - | 53404-12-9 | diss.rml.association.type.EXPERT |
| Arsenazo III sodium | 630-782-4 | 138608-19-2 | diss.rml.association.type.EXPERT |
| Aluminium gallium arsenide | 680-872-2 | 37382-15-3 | diss.rml.association.type.EXPERT |
| 4-(4-dimethylaminophenylazo)phenylarsonic acid | 210-750-2 | 622-68-4 | diss.rml.association.type.EXPERT |
| Silver hexafluoroarsenate | 624-776-0 | 12005-82-2 | diss.rml.association.type.EXPERT |
| Arsenous acid | - | 13464-58-9 | diss.rml.association.type.EXPERT |
| Lutetium arsenide | 234-477-3 | 12005-94-6 | diss.rml.association.type.EXPERT_ECHA |
| Zinc diarsenide | 234-956-7 | 12044-55-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, ammonium zinc salt | - | 94854-80-5 | diss.rml.association.type.EXPERT |
| Arsenic trichloride | 232-059-5 | 7784-34-1 | diss.rml.association.type.EXPERT_ECHA |
| [4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonic acid | 227-365-0 | 5806-89-3 | diss.rml.association.type.EXPERT |
| Tristrontium diarsenate | 236-684-4 | 13464-68-1 | diss.rml.association.type.EXPERT_ECHA |
| Digallium arsenide phosphide | 234-948-3 | 12044-20-1 | diss.rml.association.type.EXPERT_ECHA |
| Acetarsol sodium | 259-714-8 | 55588-51-7 | diss.rml.association.type.EXPERT |
| Arsenenous acid, cerium(3+) salt | - | 86859-93-0 | diss.rml.association.type.EXPERT |
| Calcium bis(dimethylarsinate) | 227-311-6 | 5785-43-3 | diss.rml.association.type.EXPERT |
| Rammelsbergite (NiAs2) | - | 1303-22-6 | diss.rml.association.type.EXPERT |
| 6,6'-dihydroxy-3,3'-diarsene-1,2-diyldianilinium dichloride | 205-386-6 | 139-93-5 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), bismuth salt (1:1) | - | 13702-38-0 | diss.rml.association.type.EXPERT |
| Trisilver arsenide | 235-652-7 | 12417-99-1 | diss.rml.association.type.EXPERT_ECHA |
| Melarsoprol | 207-793-4 | 494-79-1 | diss.rml.association.type.EXPERT |
| Arsenic oxide | - | 12777-38-7 | diss.rml.association.type.EXPERT |
| Iron diarsenide | 234-485-7 | 12006-21-2 | diss.rml.association.type.EXPERT_ECHA |
| Arsenenous acid, silver(1+) salt | - | 69507-43-3 | diss.rml.association.type.EXPERT |
| Trimethylarsine | 209-815-8 | 593-88-4 | diss.rml.association.type.EXPERT |
| Trilithium arsenide | 234-950-4 | 12044-22-3 | diss.rml.association.type.EXPERT_ECHA |
| Leucomycin V, 9-O-[5-(dimethylamino)tetrahydro-6-methyl-2H-pyran-2-yl]-, [9(5S,6R)]-, [1,2-ethanediylbis(imino-4,1-phenylene)]bis[arsonate] (1:1) (salt) | 299-051-1 | 93841-79-3 | diss.rml.association.type.EXPERT |
|
Flue dust, arsenic-contg.
Formed when arsenic and metal oxide particles are driven off during the roasting and converting of copper concentrates and matte in the production of anode copper.
|
232-434-3 | 8028-73-7 | diss.rml.association.type.EXPERT_ECHA |
| Copper acetoarsenite | 601-658-7 | 12002-03-8 | diss.rml.association.type.EXPERT |
| Arsenenous acid, mercury(2+) salt | - | 82980-40-3 | diss.rml.association.type.EXPERT |
| Cobalt arsenide (CoAs2) | - | 12044-42-7 | diss.rml.association.type.EXPERT |
| Arsenous acid, titanium salt | - | 92278-94-9 | diss.rml.association.type.EXPERT |
| Proustite (Ag3(AsS3)) | 239-179-7 | 15122-58-4 | diss.rml.association.type.EXPERT |
| Arsenenous acid, ammonium copper salt | - | 94854-78-1 | diss.rml.association.type.EXPERT |
| Arsenic(II) sulfide | - | 12044-79-0 | diss.rml.association.type.EXPERT |
| Arsenous acid, lead(2+) salt (1:1) | - | 100822-74-0 | diss.rml.association.type.EXPERT |
| Arsenious acid (HAsO2), strontium salt | - | 15195-06-9 | diss.rml.association.type.EXPERT |
| Iododimethylarsine | 211-630-2 | 676-75-5 | diss.rml.association.type.EXPERT |
| Sodium hexafluoroarsenate(V) | 624-772-9 | 12005-86-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsonic acid, tin salt | - | 93080-00-3 | diss.rml.association.type.EXPERT |
| Triethyl arsenate | 427-700-2 | 15606-95-8 | diss.rml.association.type.EXPERT |
| Gallium arsenide | 215-114-8 | 1303-00-0 | diss.rml.association.type.EXPERT_ECHA |
| Sodium dioxoarsenate | 232-070-5 | 7784-46-5 | diss.rml.association.type.EXPERT_ECHA |
| Trimagnesium diarsenide | 234-954-6 | 12044-49-4 | diss.rml.association.type.EXPERT_ECHA |
| Trisodium 2-(-hydrogen arsonatophenylazo)-1,8-dihydroxynaphthalene-3,6-disulphonate | 208-285-5 | 520-10-5 | diss.rml.association.type.EXPERT |
| Arsenenous acid, cesium salt | - | 82005-78-5 | diss.rml.association.type.EXPERT |
| Tetraphenylarsonium chloride, compound with hydrochloric acid (1:1) | 277-208-5 | 73003-83-5 | diss.rml.association.type.EXPERT |
| [2-(diphenylarsino)ethyl]diphenylphosphine | 245-758-5 | 23582-06-1 | diss.rml.association.type.EXPERT |
| Arsenic triiodide | 232-068-4 | 7784-45-4 | diss.rml.association.type.EXPERT_ECHA |
| Phenylarsine oxide | 211-275-3 | 637-03-6 | diss.rml.association.type.EXPERT_ECHA |
| Boron arsenide (B6As) | - | 12005-70-8 | diss.rml.association.type.EXPERT |
| Arsorane, pentahydroxy-, copper(2+) salt (1:2) | - | - | diss.rml.association.type.EXPERT |
| Sodium methylarsonate | 218-495-9 | 2163-80-6 | diss.rml.association.type.EXPERT |
| Sodium cacodylate trihydrate | 682-793-9 | 6131-99-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), lead(4+) salt (3:2) | - | 10102-48-4 | diss.rml.association.type.EXPERT |
| Praseodymium arsenide | 234-953-0 | 12044-28-9 | diss.rml.association.type.EXPERT_ECHA |
|
Slimes and Sludges, copper electrolytic refining, decopperized, arsenic-rich
Product obtained by centrifuging the slime discharged at the bases of cells for decopperization of electrolytic copper solutions. Composed primarily of a copper powder rich in arsenic.
|
309-772-6 | 100995-81-1 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid, magnesium salt | 233-285-7 | 10103-50-1 | diss.rml.association.type.EXPERT_ECHA |
| Calcium arsenite | 258-147-3 | 52740-16-6 | diss.rml.association.type.EXPERT |
| Pentafluoroarsorane | 232-061-6 | 7784-36-3 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid, calcium salt | 233-287-8 | 10103-62-5 | diss.rml.association.type.EXPERT_ECHA |
| Triantimony arsenide | 235-505-7 | 12255-36-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic sulfide (As2S5) | 625-728-1 | 1303-34-0 | diss.rml.association.type.EXPERT |
| (diphenylarsino)dimethylgallium | 302-587-1 | 94113-53-8 | diss.rml.association.type.EXPERT |
| Diphenyliodonium hexafluoroarsenate | 263-638-0 | 62613-15-4 | diss.rml.association.type.EXPERT_ECHA |
| Diarsenic pentaoxide | 215-116-9 | 1303-28-2 | diss.rml.association.type.EXPERT_ECHA |
| Erbium arsenide | 235-501-5 | 12254-88-5 | diss.rml.association.type.EXPERT_ECHA |
| Disodium 3-[[2-[(dihydroxyarsino)oxy]phenyl]azo]-4,5-dihydroxynaphthalene-2,7-disulphonate | 282-454-1 | 84215-48-5 | diss.rml.association.type.EXPERT |
| Sodium oxidoarsonous acid | - | 60189-99-3 | diss.rml.association.type.EXPERT |
| p-tolylarsonic acid | 223-588-2 | 3969-54-8 | diss.rml.association.type.EXPERT |
| Trisodium arsenite | 236-681-8 | 13464-37-4 | diss.rml.association.type.EXPERT_ECHA |
| Calcium arsenate (CaHAsO4) (6CI,7CI) | 672-782-7 | 15195-00-3 | diss.rml.association.type.EXPERT |
| Calcium arsenate fluoride | - | 17068-86-9 | diss.rml.association.type.EXPERT |
| Thallium arsenide | 234-481-5 | 12006-09-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic | 231-148-6 | 7440-38-2 | diss.rml.association.type.EXPERT_ECHA |
| Triethylarsine | 210-526-4 | 617-75-4 | diss.rml.association.type.EXPERT |
| 3-amino-4-hydroxyphenylarsonic acid | 218-494-3 | 2163-77-1 | diss.rml.association.type.EXPERT |
| Arsonic acid, [4-[[4-(dimethylamino)phenyl]azo]phenyl]-, monohydrochloride | 620-678-7 | 73688-85-4 | diss.rml.association.type.EXPERT |
|
Lead, antimonial, dross
A scum formed on the surface of antimonial lead. Consists primarily of sodium arsenate and sodium antimonate with some lead oxide and free caustic soda.
|
273-795-7 | 69029-51-2 | diss.rml.association.type.EXPERT_ECHA |
| Disodium [4-[(4,6-diamino-1,3,5-triazin-2-yl)amino]phenyl]arsonate | 222-749-4 | 3599-28-8 | diss.rml.association.type.EXPERT |
| Diiron arsenide | 234-474-7 | 12005-88-8 | diss.rml.association.type.EXPERT_ECHA |
| Zinc arsenenate oxide (Zn5(AsO3)4O3), tetrahydrate | - | 1303-39-5 | diss.rml.association.type.EXPERT |
| Sodium p-[[4-[3-(2-arsono-4-nitrophenyl)triazen-1-yl]phenyl]azo]benzenesulphonate | 217-197-6 | 1772-02-7 | diss.rml.association.type.EXPERT |
| 2,2'-[ethylenebis(oxy)]bis[1,3,2-dioxarsolane] | 238-911-2 | 14849-23-1 | diss.rml.association.type.EXPERT |
| Strychnine dimethylarsinate | 233-973-7 | 10476-87-6 | diss.rml.association.type.EXPERT |
| Gallium arsenic phosphide | - | 60953-19-7 | diss.rml.association.type.EXPERT |
| Potassium dihydrogenarsenate | 232-065-8 | 7784-41-0 | diss.rml.association.type.EXPERT_ECHA |
| Ammonium dihydrogenarsenate | 236-667-1 | 13462-93-6 | diss.rml.association.type.EXPERT_ECHA |
| Mercury hydrogenarsenate | 232-062-1 | 7784-37-4 | diss.rml.association.type.EXPERT_ECHA |
| Potassium arsenite | 236-680-2 | 13464-35-2 | diss.rml.association.type.EXPERT_ECHA |
| 2,6-dimethyl-4-(1-naphthyl)pyrylium hexafluoroarsenate | 282-682-1 | 84282-36-0 | diss.rml.association.type.EXPERT_ECHA |
| Phenylarsonic acid | 202-631-9 | 98-05-5 | diss.rml.association.type.EXPERT |
| 4-(glycolloylamino)phenylarsonic acid | 205-643-2 | 144-87-6 | diss.rml.association.type.EXPERT |
| Disodium arsonoacetate | 204-806-5 | 126-82-9 | diss.rml.association.type.EXPERT |
| (4-((2-Amino-2-oxoethyl)amino)phenyl)arsonic acid | - | 618-25-7 | diss.rml.association.type.EXPERT |
| Sodium 4-(glycolloylamino)phenylarsonate | 231-680-9 | 7681-83-6 | diss.rml.association.type.EXPERT |
| Cobalt arsenide | 248-168-6 | 27016-73-5 | diss.rml.association.type.EXPERT_ECHA |
| Tris[(8α,9R)-6'-methoxycinchonan-9-ol] bis(arsenate) | 208-971-4 | 549-59-7 | diss.rml.association.type.EXPERT_ECHA |
| Oxophenarsine | 206-178-8 | 306-12-7 | diss.rml.association.type.EXPERT_ECHA |
| Diammonium hydrogenarsenate | 232-067-9 | 7784-44-3 | diss.rml.association.type.EXPERT_ECHA |
| Methyl 1,2,5,6-tetrahydro-1-methylnicotinate, mono[(3-acetamido-4-hydroxyphenyl)arsonate] | 212-983-5 | 900-77-6 | diss.rml.association.type.EXPERT |
| Antimony oxide (Sb2O3), mixed with arsenic oxide (As2O3) | 273-156-2 | 68951-38-2 | diss.rml.association.type.EXPERT_ECHA |
| Triphenylarsine oxide | 214-571-0 | 1153-05-5 | diss.rml.association.type.EXPERT |
| Disodium hydrogen 2-[[7-[(2-arsonophenyl)azo]-1,8-dihydroxy-3,6-disulphonato-2-naphthyl]azo]benzoate | 238-715-7 | 14674-83-0 | diss.rml.association.type.EXPERT |
| Thiobis[methylarsine], anhydrosulphide | 236-436-5 | 13367-92-5 | diss.rml.association.type.EXPERT |
| ARSENIC(V) OXIDE HYDRATE | 629-626-8 | 12044-50-7 | diss.rml.association.type.EXPERT |
| Hydrogen hexafluoroarsenate | 241-128-9 | 17068-85-8 | diss.rml.association.type.EXPERT_ECHA |
| Vanadium(4+) diarsenate (1:1) | 308-917-0 | 99035-51-5 | diss.rml.association.type.EXPERT_ECHA |
| Dichloro(phenyl)arsine | 211-791-9 | 696-28-6 | diss.rml.association.type.EXPERT |
| Zinc arsenide | - | 56450-43-2 | diss.rml.association.type.EXPERT |
| Tris(pentane-2,4-dionato-O,O')silicon hexafluoroarsenate | 266-621-6 | 67251-38-1 | diss.rml.association.type.EXPERT_ECHA |
| Europium arsenide | 251-206-4 | 32775-46-5 | diss.rml.association.type.EXPERT_ECHA |
| Manganese arsenide (Mn2As) | - | 12005-96-8 | diss.rml.association.type.EXPERT |
| Diarsenic triselenide | 215-119-5 | 1303-36-2 | diss.rml.association.type.EXPERT_ECHA |
| Diarsenic acid, sodium salt | - | 13464-42-1 | diss.rml.association.type.EXPERT |
| 2-nitrophenylarsonic acid | 226-485-0 | 5410-29-7 | diss.rml.association.type.EXPERT |
| Diphenoxarsin-10-yl oxide | 200-377-3 | 58-36-6 | diss.rml.association.type.EXPERT |
| Arsenic acid, tripotassium salt | - | 13464-36-3 | diss.rml.association.type.EXPERT |
| Tripotassium arsenate 3/2hydrate | - | 62702-52-7 | diss.rml.association.type.EXPERT |
| Trisilver arsenate | 236-841-7 | 13510-44-6 | diss.rml.association.type.EXPERT_ECHA |
| Arsenic acid (H3AsO4), monopotassium salt, 1/5hydrate | - | 164170-84-7 | diss.rml.association.type.EXPERT |
| Arsenenous acid, neodymium(3+) salt | - | 76871-63-1 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), cobalt(2+) salt | - | 29871-10-1 | diss.rml.association.type.EXPERT |
| Tetraarsenic tetrasulfide | - | 12279-90-2 | diss.rml.association.type.EXPERT |
| Arsenic selenide | - | 12626-31-2 | diss.rml.association.type.EXPERT |
| Trisodium arsenide | 234-952-5 | 12044-25-6 | diss.rml.association.type.EXPERT_ECHA |
| Methylenebis(diphenylarsine) | 244-639-5 | 21892-63-7 | diss.rml.association.type.EXPERT |
| Arsenic acid (H3AsO4), calcium salt (4:5) | - | 89067-81-2 | diss.rml.association.type.EXPERT |
| Tricalcium diarsenite | 248-266-9 | 27152-57-4 | diss.rml.association.type.EXPERT_ECHA |
| o-phenylenediarsonic acid | 217-154-1 | 1758-48-1 | diss.rml.association.type.EXPERT |
| Calcium arsenate | 231-904-5 | 7778-44-1 | diss.rml.association.type.EXPERT_ECHA |
| Trizinc diarsenide | 234-486-2 | 12006-40-5 | diss.rml.association.type.EXPERT_ECHA |
| Sodium arsenate dibasic heptahydrate | 677-900-0 | 10048-95-0 | diss.rml.association.type.EXPERT_ECHA |
EU Privacy Disclaimer
This website uses cookies to ensure you get the best experience on our websites.