Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2,4-dichloro-3-ethyl-6-nitrophenol

Inventory

EC number:
420-740-1
EC name:
2,4-dichloro-3-ethyl-6-nitrophenol
CAS number:
-
Description:
2,4-DICHLORO-3-ETHYL-6-NITROPHENOL
CAS number:
99817-36-4
Synonyms
Names:
2-Nitro-4,6-dichloro-5-ethylphenol
DCENP
Phenol,2,4-dichloro-3-ethyl-6-nitro-
2,4-dichloro-3-ethyl-6-nitrophenol

Molecular and structural information

Molecular formula:
C8H7Cl2NO3
Molecular weight:
236.05
SMILES notation:
Clc1c(c(Cl)cc([N+]([O-])=O)c1O)CC
InChl:
InChI=1/C8H7Cl2NO3/c1-2-4-5(9)3-6(11(13)14)8(12)7(4)10/h3,12H,2H2,1H3
Structural formula:
Chemical structure

Related substances

Categories Display