Registration Dossier

IUPAC name:
2-[benzyl(2-hydroxyethyl)amino]-1-phenylethanol

Inventory

CAS number:
23175-18-0

Synonyms

Molecular and structural information

Molecular formula:
C17H21NO2
Molecular weight:
271.35
SMILES notation:
c1ccccc1C(O)CN(CCO)Cc2ccccc2
InChl:
InChI=1S/C17H21NO2/c19-12-11-18(13-15-7-3-1-4-8-15)14-17(20)16-9-5-2-6-10-16/h1-10,17,19-20H,11-14H2
Structural formula:
Chemical structure

Related substances