Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
(E) but-2-enedioic acid

Inventory

EC number:
203-743-0
EC name:
Fumaric acid
CAS number:
110-17-8
CAS number:
110-17-8
Synonyms
Names:
2-Butenedioic acid (2E)-
2-Butenedioic acid (E)-

Molecular and structural information

Molecular formula:
C4H4O4
Molecular weight:
116.072
SMILES notation:
OC(=O)\C=C\C(=O)O
InChl:
InChI=1/C4H4O4/c5-3(6)1-2-4(7)8/h1-2H,(H,5,6)(H,7,8)
Structural formula:
Chemical structure

Related substances