Registration Dossier

IUPAC name:
N,N-dimethyl-3-(1-naphthyloxy)-3-(2-thienyl)propan-1-amine oxalate

Inventory

CAS number:
116817-12-0

Synonyms

Molecular and structural information

Molecular formula:
C19H21NOS.C2H2O4
Molecular weight:
ca. 401.48
SMILES notation:
s1cccc1C(CCN(C)C)Oc2cccc3ccccc23.C(C(=O)O)(O)=O
InChl:
1/C19H21NOS.C2H2O4/c1-20(2)13-12-18(19-11-6-14-22-19)21-17-10-5-8-15-7-3-4-9-16(15)17;3-1(4)2(5)6/h3-11,14,18H,12-13H2,1-2H3;(H,3,4)(H,5,6)
Structural formula:
Chemical structure

Related substances