Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
cis,cis,cis-9,12,15-Octadecatrienoic acid

Inventory

EC number:
207-334-8
EC name:
Linolenic acid
CAS number:
463-40-1
CAS number:
463-40-1

Synonyms

Molecular and structural information

Molecular formula:
C18H30O2
Molecular weight:
278.43
SMILES notation:
O=C(O)CCCCCCC\C=C/C\C=C/C\C=C/CC
Structural formula:
Chemical structure

Related substances