Registration Dossier

Reference substances

Reference substances

IUPAC name:
2,3,4,5-tetrafluorobenzoyl chloride

Inventory

CAS number:
94695-48-4
Synonyms
Names:
2,3,4,5- Tetrafluorobenzoyl chloride

Molecular and structural information

Molecular formula:
C7HClF4O
Molecular weight:
ca. 212.53
SMILES notation:
O=C(Cl)c1cc(F)c(F)c(F)c1F
Structural formula:
Chemical structure

Related substances