Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2-hydroxy-4-(methylthio)butanoic acid

Inventory

EC number:
209-523-0
EC name:
2-hydroxy-4-(methylthio)butyric acid
CAS number:
583-91-5
CAS number:
583-91-5
Synonyms
Names:
Butanoic acid, 2-hydroxy-4-(methylthio)-

Molecular and structural information

Molecular formula:
C5H10O3S
Molecular weight:
150.196
SMILES notation:
CSCCC(O)C(=O)O
InChl:
InChI=1/C5H10O3S/c1-9-3-2-4(6)5(7)8/h4,6H,2-3H2,1H3,(H,7,8)
Structural formula:
Chemical structure

Related substances