Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
sodium hydrogen 2-aminobenzene-1,4-disulphonate

Inventory

EC number:
246-349-4
EC name:
Sodium hydrogen 2-aminobenzene-1,4-disulphonate
CAS number:
24605-36-5
CAS number:
24605-36-5
Synonyms
Names:
1,4-Benzenedisulfonic acid, 2-amino-, monosodium salt
sodium hydrogen 2-aminobenzene-1,4-disulfonate

Molecular and structural information

Molecular formula:
C6H7NO6S2.Na
Molecular weight:
274.227
SMILES notation:
[Na+].Nc1cc(ccc1S(=O)(=O)[O-])S(=O)(=O)[O-]
InChl:
InChI=1/C6H7NO6S2.Na/c7-5-3-4(14(8,9)10)1-2-6(5)15(11,12)13;/h1-3H,7H2,(H,8,9,10)(H,11,12,13);/q;+1/p-2
Structural formula:
Chemical structure

Related substances