Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
hydrogen [amino(hydroxy)methylidene]azanium sulfate

Inventory

EC number:
244-343-6
EC name:
Uronium hydrogen sulphate
CAS number:
21351-39-3
CAS number:
21351-39-3
Synonyms
Names:
Monocarbamide dihydrogen sulphate
Urea sulfate
Urea, sulfate (1:1)
Identifier:
IUPAC name
amino(hydroxy)methaniminium hydrogen sulphate
amino(hydroxy)methaniminium hydrogen sulfate

Molecular and structural information

Molecular formula:
CH4N2O.H2O4S
Molecular weight:
157.126
SMILES notation:
NC(=[NH2+])O.[O-]S(=O)(=O)[O-]
InChl:
InChI=1/CH4N2O.H2O4S/c2-1(3)4;1-5(2,3)4/h(H4,2,3,4);(H2,1,2,3,4)/p-1
Structural formula:
Chemical structure

Related substances