Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
bis[amino(imino)methanaminium] carbonate

Inventory

EC number:
209-813-7
EC name:
Diguanidinium carbonate
CAS number:
593-85-1
CAS number:
593-85-1
Synonyms
Names:
Bisguanidinium carbonate
Carbonic acid, compd. with guanidine (1:2)
Diguanidinium carbonate
Guanidine, carbonate

Molecular and structural information

Molecular formula:
CH5N3.1/2CH2O3 (one guanidine species, as denoted in the ESIS database)
CH5N3.CH5N3.CH2O3 (as in the crystalline from, basis for the molecular weight 180.1658 g/mol as given below)
Molecular weight:
180.166
SMILES notation:
NC(=N)[NH3+].NC(=N)[NH3+].[O-]C(=O)[O-]
InChl:
InChI=1/2CH5N3.CH2O3/c3*2-1(3)4/h2*(H5,2,3,4);(H2,2,3,4)
Structural formula:
Chemical structure

Related substances