Registration Dossier

Diss Factsheets

IUPAC name:
tert-butyl 4-[[(6-amino-5-chloro-pyrimidin-4-yl)amino]methyl]-4-fluoro-piperidine-1-carboxylate

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C₁₅H₂₃ClFN₅O₂
Molecular weight:
359.83
SMILES notation:
CC(C)(C)OC(=O)N1CCC(F)(CC1)CNC2=C(Cl)C(=NC=N2)N
InChl:
InChI=1S/C15H23ClFN5O2/c1-14(2,3)24-13(23)22-6-4-15(17,5-7-22)8-19-12-10(16)11(18)20-9-21-12/h9H,4-8H2,1-3H3,(H3,18,19,20,21)
Structural formula:
Chemical structure

Related substances