Registration Dossier

Diss Factsheets

IUPAC name:
tert-butyl 4-[(E)-3-(dimethylamino)prop-2-enoyl]piperidine-1-carboxylate

Inventory

CAS number:
1799799-87-3

Synonyms

Molecular and structural information

Molecular formula:
C15H26N2O3
Molecular weight:
ca. 282.48
SMILES notation:
CN(C)\C=C\C(=O)C1CCN(CC1)C(=O)OC(C)(C)C
Structural formula:
Chemical structure

Related substances

Categories Display