Registration Dossier

IUPAC name:
N1,N2-dimethyl-N1-{2-[methyl(propan-2-yl)amino]ethyl}-N2-(propan-2-yl)ethane-1,2-diamine

Inventory

CAS number:
1042950-30-0

Synonyms

Molecular and structural information

Molecular formula:
C13H31N3
Molecular weight:
229.41
SMILES notation:
CC(N(C)CCN(C)CCN(C)C(C)C)C
InChl:
InChI=1S/C13H31N3/c1-12(2)15(6)10-8-14(5)9-11-16(7)13(3)4/h12-13H,8-11H2,1-7H3
Structural formula:
Chemical structure

Related substances