Registration Dossier

Diss Factsheets

IUPAC name:
1-[Bis(9,9-dimethyl-9H-fluoren-2-yl)amino]-9H-fluoren-9-one

Inventory

CAS number:
1659314-59-6

Synonyms

Molecular and structural information

Molecular formula:
C43H33NO
Molecular weight:
579.73
SMILES notation:
CC1(C)C2=CC=CC=C2C2=CC=C(C=C12)N(C1=CC=C2C3=CC=CC=C3C(C)(C)C2=C1)C1=C2C(=O)C3=CC=CC=C3C2=CC=C1
InChl:
1S/C43H33NO/c1-42(2)35-17-9-7-13-29(35)31-22-20-26(24-37(31)42)44(39-19-11-16-33-28-12-5-6-15-34(28)41(45)40(33)39)27-21-23-32-30-14-8-10-18-36(30)43(3,4)38(32)25-27/h5-25H,1-4H3
Structural formula:
Chemical structure

Related substances