Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
[4-(3-methoxypropoxy)-3-methylpyridin-2-yl]methanol hydrochloride

Inventory

CAS number:
675198-19-3
Synonyms
Names:
Identifier:
other: chemical name
(4-(3-methoxypropoxy)-3-methylpyridin-2-yl)methanol hydrochloride
Identifier:
other: chemical name
2-(Hydroxymethyl)-4-(3-methoxypropoxy)-3-methylpyridinium chloride
2-Hydroxymethyl-4-(3-methoxypropoxy)-3-methylpyridine hydrochloride

Molecular and structural information

Molecular formula:
C11H17NO3.ClH
Molecular weight:
247.72
SMILES notation:
CC1=C(OCCCOC)C=CN=C1CO.Cl
InChl:
InChI=1S/C11H17NO3.ClH/c1-9-10(8-13)12-5-4-11(9)15-7-3-6-14-2;/h4-5,13H,3,6-8H2,1-2H3;1H
Structural formula:
Chemical structure

Related substances

Identifier:
CAS number
Identity:
118175-10-3