Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
2,2-bis(hydroxymethyl)butyl 12-hydroxyoctadec-9-enoate

Inventory

EC number:
266-551-6
EC name:
2,2-bis(hydroxymethyl)butyl (R)-12-hydroxyoleate
CAS number:
67025-99-4
CAS number:
67025-99-4
Synonyms
Names:
Identifier:
IUPAC name
2,2-bis(hydroxymethyl)butyl (R)-12-hydroxyoleate
Identifier:
other: SMILES notation
CCCCCC[C@@H](O)C\C=C/CCCCCCCC(=O)OCC(CC)(CO)CO

Molecular and structural information

Molecular formula:
C24H46O5
Molecular weight:
414.619
SMILES notation:
C(COC(=O)CCCCCCCC=CCC(CCCCCC)O)(CO)(CC)CO
InChl:
InChI=1/C24H46O5/c1-3-5-6-13-16-22(27)17-14-11-9-7-8-10-12-15-18-23(28)29-21-24(4-2,19-25)20-26/h11,14,22,25-27H,3-10,12-13,15-21H2,1-2H3
Structural formula:
Chemical structure

Related substances