Registration Dossier

IUPAC name:
(R)-5-Bromo-3-[(1-methyl-2-pyrrolidinyl)methyl]-1H-indol oxalate

Inventory

CAS number:
1196663-29-2

Synonyms

Molecular and structural information

Molecular formula:
C16H19BrN2O4
Molecular weight:
383.23
SMILES notation:
Brc1ccc2ncc(c2c1)C(=O)[C@H]4CCCN4C(=O)OCc3ccccc3
Structural formula:
Chemical structure

Related substances