Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1-(2-{(2-Hydroxy-3-phenoxy-propyl)-[2-(2-hydroxy-3-phenoxy-propylamino)-ethyl]-amino}-ethylamino)-3-phenoxy-propan-2-ol

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C31H43N3O6
Molecular weight:
553.69
SMILES notation:
N(CC(COC1=CC=CC=C1)O[H])(CCN(CC(COC2=CC=CC=C2)O[H])[H])CCN(CC(COC3=CC=CC=C3)O[H])[H]
InChl:
InChI=1S/C31H43N3O6/c35-26(23-38-29-10-4-1-5-11-29)20-32-16-18-34(22-28(37)25-40-31-14-8-3-9-15-31)19-17-33-21-27(36)24-39-30-12-6-2-7-13-30/h1-15,26-28,32-33,35-37H,16-25H2
Structural formula:
Chemical structure

Related substances