Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
3,5-dichlorobenzoic acid

Inventory

EC number:
200-092-4
EC name:
3,5-dichlorobenzoic acid
CAS number:
51-36-5
CAS number:
51-36-5
Synonyms
Names:
3,5-dichlorobenzoic_acid
3,5-dichlorobenzoic acid

Molecular and structural information

Molecular formula:
C7H4Cl2O2
Molecular weight:
191.012
SMILES notation:
OC(=O)c1cc(Cl)cc(Cl)c1
InChl:
InChI=1/C7H4Cl2O2/c8-5-1-4(7(10)11)2-6(9)3-5/h1-3H,(H,10,11)
Structural formula:
Chemical structure

Related substances