Registration Dossier

Diss Factsheets

IUPAC name:
2-[2-[2-[2-[2-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]ethoxy]ethoxy]ethyl methanesulfonate

Inventory

CAS number:
477775-57-8

Synonyms

Molecular and structural information

Molecular formula:
C16 H34 O10 S
Molecular weight:
418.51
SMILES notation:
COCCOCCOCCOCCOCCOCCOCCOS(=O)(=O)C
InChl:
-
Structural formula:
Chemical structure

Related substances