Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
trimethyl(octyl)azanium methyl sulfate

Inventory

EC number:
265-332-2
EC name:
Trimethyloctylammonium methyl sulphate
CAS number:
65059-42-9
CAS number:
65059-42-9
Synonyms
Names:
1-Octanaminium, N,N,N-trimethyl-, methyl sulfate
N,N,N-trimethyloctan-1-aminium methyl sulfate

Molecular and structural information

Molecular formula:
C11H26N.CH3O4S
Molecular weight:
283.428
SMILES notation:
CCCCCCCC[N+](C)(C)C.COS(=O)(=O)[O-]
InChl:
InChI=1/C11H26N.CH4O4S/c1-5-6-7-8-9-10-11-12(2,3)4;1-5-6(2,3)4/h5-11H2,1-4H3;1H3,(H,2,3,4)/q+1;/p-1
Structural formula:
Chemical structure

Related substances

Categories Display