Registration Dossier

Diss Factsheets

Reference substances

Reference substances

Currently viewing:
IUPAC name:
tetrabutylphosphanium chloride

Inventory

EC number:
218-964-8
EC name:
Tetrabutylphosphonium chloride
CAS number:
2304-30-5
CAS number:
2304-30-5
Synonyms
Names:
Phosphonium, tetrabutyl-, chloride
tetrabutylphosphonium chloride

Molecular and structural information

Molecular formula:
C16H36P.Cl
Molecular weight:
294.884
SMILES notation:
[Cl-].CCCC[P+](CCCC)(CCCC)CCCC
InChl:
InChI=1/C16H36P.ClH/c1-5-9-13-17(14-10-6-2,15-11-7-3)16-12-8-4;/h5-16H2,1-4H3;1H/q+1;/p-1
Structural formula:
Chemical structure

Related substances