Registration Dossier

IUPAC name:
2-(7-Methoxynaphthalen-1-yl)acetonitrile

Inventory

EC number:
461-670-1
EC name:
-
CAS number:
-
CAS number:
138113-08-3

Synonyms

Molecular and structural information

Molecular formula:
C13H11NO
Molecular weight:
197.23
SMILES notation:
COC2=CC1=C(C=CC=C1CC#N)C=C2
InChl:
InChI=1S/C13H11NO/c1-15-12-6-5-10-3-2-4-11(7-8-14)13(10)9-12/h2-6,9H,7H2,1H3
Structural formula:
Chemical structure

Related substances