Registration Dossier

Diss Factsheets

Reference substances

Reference substances

IUPAC name:
2-hydroxy-N-(4-hydroxyphenyl)benzamide

Inventory

EC number:
208-385-9
EC name:
Osalmid
CAS number:
526-18-1
CAS number:
526-18-1
Synonyms
Names:
Identifier:
common name
Osalmid Driol
2-hydroxy-N-(4-hydroxyphenyl)benzamide

Molecular and structural information

Molecular formula:
C13H11NO3
Molecular weight:
229.24
SMILES notation:
Oc1c(C(=O)Nc2ccc(O)cc2)cccc1
Structural formula:
Chemical structure

Related substances