Registration Dossier

Reference substances

Reference substances

Currently viewing:
IUPAC name:
1-(4-{2-[4-(3-{[3-(diethylamino)propyl][3-(4-{2-[4-(3-{[3-(diethylamino)propyl][3-(4-{2-[4-(3-{[3-(diethylamino)propyl]amino}-2-hydroxypropoxy)phenyl]propan-2-yl}phenoxy)-2-hydroxypropyl]amino}-2-hydroxypropoxy)phenyl]propan-2-yl}phenoxy)-2-hydroxypropyl]amino}-2-hydroxypropoxy)phenyl]propan-2-yl}phenoxy)-3-{[3-(diethylamino)propyl][3-(4-{2-[4-(3-{[3-(diethylamino)propyl]amino}-2-hydroxypropoxy)phenyl]propan-2-yl}phenoxy)-2-hydroxypropyl]amino}propan-2-ol

Inventory

Synonyms

Molecular and structural information

Molecular formula:
C116H182N10O16
Molecular weight:
1 972.74
SMILES notation:
CCN(CC)CCCNCC(O)COc8ccc(C(C)(C)c7ccc(OCC(O)CN(CCCN(CC)CC)CC(O)CCOc6ccc(C(C)(C)c5ccc(OCC(O)CN(CCCN(CC)CC)CC(O)COc4ccc(C(C)(C)c3ccc(CCC(O)CN(CCCN(CC)CC)CC(O)COc2ccc(C(C)(C)c1ccc(OCC(O)CNCCCN(CC)CC)cc1)cc2)cc3)cc4)cc5)cc6)cc7)cc8
Structural formula:
Chemical structure

Related substances